C13H20F2N4O — CID 78997921
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]methanamine (PubChem CID 78997921) has the molecular formula C13H20F2N4O and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]methanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]methanamine |
|---|---|
| PubChem CID | 78997921 |
| Molecular Formula | C13H20F2N4O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]methanamine |
| SMILES | FC(F)n1ccnc1CNCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C13H20F2N4O/c14-13(15)19-5-3-17-12(19)7-16-6-11-8-18-4-1-2-10(18)9-20-11/h3,5,10-11,13,16H,1-2,4,6-9H2 |
| InChIKey | SDBXXDGDIXEZHN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |