C12H19NO2 — CID 78998469
3-[(3-methoxyphenyl)methylamino]butan-1-ol (PubChem CID 78998469) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-[(3-methoxyphenyl)methylamino]butan-1-ol.
| Compound Name | 3-[(3-methoxyphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 78998469 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-[(3-methoxyphenyl)methylamino]butan-1-ol |
| SMILES | COc1cccc(CNC(C)CCO)c1 |
| InChI | InChI=1S/C12H19NO2/c1-10(6-7-14)13-9-11-4-3-5-12(8-11)15-2/h3-5,8,10,13-14H,6-7,9H2,1-2H3 |
| InChIKey | IEKNCVUKEFSPMI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |