C11H10F3NO5S — CID 79000328
(2R,4R)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 79000328) has the molecular formula C11H10F3NO5S and a molecular weight of 325.26 g/mol. Its IUPAC name is (2R,4R)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79000328 |
| Molecular Formula | C11H10F3NO5S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (2R,4R)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](O)CN1S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H10F3NO5S/c12-6-1-2-8(10(14)9(6)13)21(19,20)15-4-5(16)3-7(15)11(17)18/h1-2,5,7,16H,3-4H2,(H,17,18)/t5-,7-/m1/s1 |
| InChIKey | DCNAUPHFTOKZJM-IYSWYEEDSA-N |
| XLogP | 0.31 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|