About 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol
3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol (PubChem CID 79001840) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol |
| PubChem CID | 79001840 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol |
| SMILES | NCC1COC(c2cccc(O)c2)O1 |
| InChI | InChI=1S/C10H13NO3/c11-5-9-6-13-10(14-9)7-2-1-3-8(12)4-7/h1-4,9-10,12H,5-6,11H2 |
| InChIKey | NUVITRLLZXSJPC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol?
The IUPAC name of 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol (CID 79001840) is 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol.
What is the SMILES notation for 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol?
The canonical SMILES for 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol is NCC1COC(c2cccc(O)c2)O1.
What is the InChIKey of 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol?
The InChIKey is NUVITRLLZXSJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c11-5-9-6-13-10(14-9)7-2-1-3-8(12)4-7/h1-4,9-10,12H,5-6,11H2.
What are the key properties of 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol?
3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol has a molecular weight of 195.22 g/mol, XLogP of 0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(aminomethyl)-1,3-dioxolan-2-yl]phenol is sourced from PubChem (CID 79001840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).