About 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine
6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 79001894) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 79001894 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1cc(Cl)cc2c1OCCN2 |
| InChI | InChI=1S/C9H10ClNO/c1-6-4-7(10)5-8-9(6)12-3-2-11-8/h4-5,11H,2-3H2,1H3 |
| InChIKey | BBVKCNCNVQNXGE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine (CID 79001894) is 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine is Cc1cc(Cl)cc2c1OCCN2.
What is the InChIKey of 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is BBVKCNCNVQNXGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO/c1-6-4-7(10)5-8-9(6)12-3-2-11-8/h4-5,11H,2-3H2,1H3.
What are the key properties of 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine?
6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 183.64 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-methyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 79001894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).