C8H8F3N — CID 79002278
2,2-difluoro-1-(3-fluorophenyl)ethanamine (PubChem CID 79002278) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is 2,2-difluoro-1-(3-fluorophenyl)ethanamine.
| Compound Name | 2,2-difluoro-1-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 79002278 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2,2-difluoro-1-(3-fluorophenyl)ethanamine |
| SMILES | NC(c1cccc(F)c1)C(F)F |
| InChI | InChI=1S/C8H8F3N/c9-6-3-1-2-5(4-6)7(12)8(10)11/h1-4,7-8H,12H2 |
| InChIKey | YGJMOQTWRJAIDH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |