About [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol
[(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol (PubChem CID 79003092) has the molecular formula C8H14F3NO
and a molecular weight of 197.20 g/mol. Its IUPAC name is [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol |
| PubChem CID | 79003092 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1CCC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO/c9-8(10,11)3-5-12-4-1-2-7(12)6-13/h7,13H,1-6H2/t7-/m0/s1 |
| InChIKey | XGVBSDAKXCAFDB-ZETCQYMHSA-N |
| XLogP | 1.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol?
The IUPAC name of [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol (CID 79003092) is [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol is OC[C@@H]1CCCN1CCC(F)(F)F.
What is the InChIKey of [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol?
The InChIKey is XGVBSDAKXCAFDB-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H14F3NO/c9-8(10,11)3-5-12-4-1-2-7(12)6-13/h7,13H,1-6H2/t7-/m0/s1.
What are the key properties of [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol?
[(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol has a molecular weight of 197.20 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 79003092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).