C11H17N5 — CID 79003445
2-(1-methylpyrazol-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine (PubChem CID 79003445) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine.
| Compound Name | 2-(1-methylpyrazol-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 79003445 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-N-(2-pyrazol-1-ylethyl)ethanamine |
| SMILES | Cn1cc(CCNCCn2cccn2)cn1 |
| InChI | InChI=1S/C11H17N5/c1-15-10-11(9-14-15)3-5-12-6-8-16-7-2-4-13-16/h2,4,7,9-10,12H,3,5-6,8H2,1H3 |
| InChIKey | ZMKBTJFRWXQLIF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|