About 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile
3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile (PubChem CID 79004072) has the molecular formula C12H14N4S
and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile |
| PubChem CID | 79004072 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1cn2ccsc2n1)C1CC1 |
| InChI | InChI=1S/C12H14N4S/c13-4-1-5-15(11-2-3-11)8-10-9-16-6-7-17-12(16)14-10/h6-7,9,11H,1-3,5,8H2 |
| InChIKey | AMOLEKCPHLEXAC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile?
The IUPAC name of 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile (CID 79004072) is 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile.
What is the SMILES notation for 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile?
The canonical SMILES for 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile is N#CCCN(Cc1cn2ccsc2n1)C1CC1.
What is the InChIKey of 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile?
The InChIKey is AMOLEKCPHLEXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4S/c13-4-1-5-15(11-2-3-11)8-10-9-16-6-7-17-12(16)14-10/h6-7,9,11H,1-3,5,8H2.
What are the key properties of 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile?
3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile has a molecular weight of 246.34 g/mol, XLogP of 2.27, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)amino]propanenitrile is sourced from PubChem (CID 79004072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).