About [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine
[2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine (PubChem CID 79004360) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine |
| PubChem CID | 79004360 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine |
| SMILES | Cc1cccc(-c2nc3ccc(CN)cc3[nH]2)c1C |
| InChI | InChI=1S/C16H17N3/c1-10-4-3-5-13(11(10)2)16-18-14-7-6-12(9-17)8-15(14)19-16/h3-8H,9,17H2,1-2H3,(H,18,19) |
| InChIKey | ZCTWONZVVSIQOD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine?
The IUPAC name of [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine (CID 79004360) is [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine.
What is the SMILES notation for [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine?
The canonical SMILES for [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine is Cc1cccc(-c2nc3ccc(CN)cc3[nH]2)c1C.
What is the InChIKey of [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine?
The InChIKey is ZCTWONZVVSIQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c1-10-4-3-5-13(11(10)2)16-18-14-7-6-12(9-17)8-15(14)19-16/h3-8H,9,17H2,1-2H3,(H,18,19).
What are the key properties of [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine?
[2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine has a molecular weight of 251.33 g/mol, XLogP of 3.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dimethylphenyl)-3H-benzimidazol-5-yl]methanamine is sourced from PubChem (CID 79004360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).