C10H8F5N3 — CID 79004482
[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]methanamine (PubChem CID 79004482) has the molecular formula C10H8F5N3 and a molecular weight of 265.19 g/mol. Its IUPAC name is [2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]methanamine.
| Compound Name | [2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 79004482 |
| Molecular Formula | C10H8F5N3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | [2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]methanamine |
| SMILES | NCc1ccc2nc(C(F)(F)C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C10H8F5N3/c11-9(12,10(13,14)15)8-17-6-2-1-5(4-16)3-7(6)18-8/h1-3H,4,16H2,(H,17,18) |
| InChIKey | CUUYCMGRYOLFOQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|