C14H6F3N3 — CID 79004638
2-(2,4,6-trifluorophenyl)-3H-benzimidazole-5-carbonitrile (PubChem CID 79004638) has the molecular formula C14H6F3N3 and a molecular weight of 273.22 g/mol. Its IUPAC name is 2-(2,4,6-trifluorophenyl)-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-(2,4,6-trifluorophenyl)-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 79004638 |
| Molecular Formula | C14H6F3N3 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-(2,4,6-trifluorophenyl)-3H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(-c3c(F)cc(F)cc3F)[nH]c2c1 |
| InChI | InChI=1S/C14H6F3N3/c15-8-4-9(16)13(10(17)5-8)14-19-11-2-1-7(6-18)3-12(11)20-14/h1-5H,(H,19,20) |
| InChIKey | BXMSZLJVUBUUPP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |