About 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione
6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione (PubChem CID 790054) has the molecular formula C10H7ClN2O2
and a molecular weight of 222.63 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione |
| PubChem CID | 790054 |
| Molecular Formula | C10H7ClN2O2 |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione |
| SMILES | O=c1cc(-c2ccc(Cl)cc2)[nH][nH]c1=O |
| InChI | InChI=1S/C10H7ClN2O2/c11-7-3-1-6(2-4-7)8-5-9(14)10(15)13-12-8/h1-5H,(H,12,14)(H,13,15) |
| InChIKey | TUBNNPCYSWXMBQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione?
The IUPAC name of 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione (CID 790054) is 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione.
What is the SMILES notation for 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione?
The canonical SMILES for 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione is O=c1cc(-c2ccc(Cl)cc2)[nH][nH]c1=O.
What is the InChIKey of 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione?
The InChIKey is TUBNNPCYSWXMBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN2O2/c11-7-3-1-6(2-4-7)8-5-9(14)10(15)13-12-8/h1-5H,(H,12,14)(H,13,15).
What are the key properties of 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione?
6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione has a molecular weight of 222.63 g/mol, XLogP of 1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-1,2-dihydropyridazine-3,4-dione is sourced from PubChem (CID 790054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).