About 2-amino-6-propyl-1H-1,3,5-triazine-4-thione
2-amino-6-propyl-1H-1,3,5-triazine-4-thione (PubChem CID 79006244) has the molecular formula C6H10N4S
and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-amino-6-propyl-1H-1,3,5-triazine-4-thione.
Molecular Properties
| Compound Name | 2-amino-6-propyl-1H-1,3,5-triazine-4-thione |
| PubChem CID | 79006244 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-amino-6-propyl-1H-1,3,5-triazine-4-thione |
| SMILES | CCCc1nc(=S)nc(N)[nH]1 |
| InChI | InChI=1S/C6H10N4S/c1-2-3-4-8-5(7)10-6(11)9-4/h2-3H2,1H3,(H3,7,8,9,10,11) |
| InChIKey | BCLLZYUJCATSSW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-propyl-1H-1,3,5-triazine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-propyl-1H-1,3,5-triazine-4-thione?
The IUPAC name of 2-amino-6-propyl-1H-1,3,5-triazine-4-thione (CID 79006244) is 2-amino-6-propyl-1H-1,3,5-triazine-4-thione.
What is the SMILES notation for 2-amino-6-propyl-1H-1,3,5-triazine-4-thione?
The canonical SMILES for 2-amino-6-propyl-1H-1,3,5-triazine-4-thione is CCCc1nc(=S)nc(N)[nH]1.
What is the InChIKey of 2-amino-6-propyl-1H-1,3,5-triazine-4-thione?
The InChIKey is BCLLZYUJCATSSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4S/c1-2-3-4-8-5(7)10-6(11)9-4/h2-3H2,1H3,(H3,7,8,9,10,11).
What are the key properties of 2-amino-6-propyl-1H-1,3,5-triazine-4-thione?
2-amino-6-propyl-1H-1,3,5-triazine-4-thione has a molecular weight of 170.24 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-propyl-1H-1,3,5-triazine-4-thione is sourced from PubChem (CID 79006244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).