About [(2,6-dimethyloxan-4-ylidene)amino]urea
[(2,6-dimethyloxan-4-ylidene)amino]urea (PubChem CID 79006304) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is [(2,6-dimethyloxan-4-ylidene)amino]urea.
Molecular Properties
| Compound Name | [(2,6-dimethyloxan-4-ylidene)amino]urea |
| PubChem CID | 79006304 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | [(2,6-dimethyloxan-4-ylidene)amino]urea |
| SMILES | CC1CC(=NNC(N)=O)CC(C)O1 |
| InChI | InChI=1S/C8H15N3O2/c1-5-3-7(4-6(2)13-5)10-11-8(9)12/h5-6H,3-4H2,1-2H3,(H3,9,11,12) |
| InChIKey | UVIOQSUQSOUTLB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2,6-dimethyloxan-4-ylidene)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,6-dimethyloxan-4-ylidene)amino]urea?
The IUPAC name of [(2,6-dimethyloxan-4-ylidene)amino]urea (CID 79006304) is [(2,6-dimethyloxan-4-ylidene)amino]urea.
What is the SMILES notation for [(2,6-dimethyloxan-4-ylidene)amino]urea?
The canonical SMILES for [(2,6-dimethyloxan-4-ylidene)amino]urea is CC1CC(=NNC(N)=O)CC(C)O1.
What is the InChIKey of [(2,6-dimethyloxan-4-ylidene)amino]urea?
The InChIKey is UVIOQSUQSOUTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-5-3-7(4-6(2)13-5)10-11-8(9)12/h5-6H,3-4H2,1-2H3,(H3,9,11,12).
What are the key properties of [(2,6-dimethyloxan-4-ylidene)amino]urea?
[(2,6-dimethyloxan-4-ylidene)amino]urea has a molecular weight of 185.23 g/mol, XLogP of 0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,6-dimethyloxan-4-ylidene)amino]urea is sourced from PubChem (CID 79006304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).