5-hydroxy-2-phenylpentanoic acid

C11H14O3 — CID 79006638

IUPAC5-hydroxy-2-phenylpentanoic acid
SMILESO=C(O)C(CCCO)c1ccccc1
InChIInChI=1S/C11H14O3/c12-8-4-7-10(11(13)14)9-5-2-1-3-6-9/h1-3,5-6,10,12H,4,7-8H2,(H,13,14)
InChIKeyVNKONHJUIKNTOS-UHFFFAOYSA-N
MW194.23 g/mol
LogP1.63
Rot. Bonds5

About 5-hydroxy-2-phenylpentanoic acid

5-hydroxy-2-phenylpentanoic acid (PubChem CID 79006638) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-hydroxy-2-phenylpentanoic acid.

Molecular Properties

Compound Name5-hydroxy-2-phenylpentanoic acid
PubChem CID79006638
Molecular FormulaC11H14O3
Molecular Weight194.23 g/mol
Exact Mass194.09
IUPAC Name5-hydroxy-2-phenylpentanoic acid
SMILESO=C(O)C(CCCO)c1ccccc1
InChIInChI=1S/C11H14O3/c12-8-4-7-10(11(13)14)9-5-2-1-3-6-9/h1-3,5-6,10,12H,4,7-8H2,(H,13,14)
InChIKeyVNKONHJUIKNTOS-UHFFFAOYSA-N
XLogP1.63
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 51.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-hydroxy-2-phenylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

7-methyl-2-phenyloctanoic acid
CID 83162771
(2S)-2,5-diphenylpentanoic acid
CID 7054365
6-iodo-2-phenylhexanoic acid
CID 134916404
2-phenyloctadecanedioic acid
CID 23016344
6-iodo-2-phenylheptanoic acid
CID 134916337
2-phenylhept-6-ynoic acid
CID 81008410
sodium;4-amino-2-phenylbutanoic acid;hydride
CID 174638608
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-phenyloctadecanoic acid
CID 68846606
4-(1-carboxy-4-phenylbutyl)benzoic acid
CID 82136611
10-hydroxy-2-phenyloctadecanoic acid
CID 67642354
(2R)-4,4-difluoro-2-phenylbutanoic acid
CID 95757342
(2S)-2-phenylhex-5-enoic acid
CID 92982258

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-2-phenylpentanoic acid?
The IUPAC name of 5-hydroxy-2-phenylpentanoic acid (CID 79006638) is 5-hydroxy-2-phenylpentanoic acid.
What is the SMILES notation for 5-hydroxy-2-phenylpentanoic acid?
The canonical SMILES for 5-hydroxy-2-phenylpentanoic acid is O=C(O)C(CCCO)c1ccccc1.
What is the InChIKey of 5-hydroxy-2-phenylpentanoic acid?
The InChIKey is VNKONHJUIKNTOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c12-8-4-7-10(11(13)14)9-5-2-1-3-6-9/h1-3,5-6,10,12H,4,7-8H2,(H,13,14).
What are the key properties of 5-hydroxy-2-phenylpentanoic acid?
5-hydroxy-2-phenylpentanoic acid has a molecular weight of 194.23 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-phenylpentanoic acid is sourced from PubChem (CID 79006638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).