C10H14N2 — CID 79006650
2,7-dimethyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 79006650) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,7-dimethyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 2,7-dimethyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 79006650 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,7-dimethyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Cc1ccc2c(c1)NC(C)CN2 |
| InChI | InChI=1S/C10H14N2/c1-7-3-4-9-10(5-7)12-8(2)6-11-9/h3-5,8,11-12H,6H2,1-2H3 |
| InChIKey | KHKAGLDMSLYGLA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |