C12H24N2 — CID 79006687
N-(4-methylpentyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 79006687) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N-(4-methylpentyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(4-methylpentyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 79006687 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-(4-methylpentyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | CC(C)CCCNC1=NCCCCC1 |
| InChI | InChI=1S/C12H24N2/c1-11(2)7-6-10-14-12-8-4-3-5-9-13-12/h11H,3-10H2,1-2H3,(H,13,14) |
| InChIKey | VQBIUADGVRYKDU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|