About 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline
6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 79006725) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 79006725 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | COc1ccc2c(c1)N(C)CCN2 |
| InChI | InChI=1S/C10H14N2O/c1-12-6-5-11-9-4-3-8(13-2)7-10(9)12/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | VPTVSHRBUWFHMA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline (CID 79006725) is 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline is COc1ccc2c(c1)N(C)CCN2.
What is the InChIKey of 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline?
The InChIKey is VPTVSHRBUWFHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-12-6-5-11-9-4-3-8(13-2)7-10(9)12/h3-4,7,11H,5-6H2,1-2H3.
What are the key properties of 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline?
6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline has a molecular weight of 178.23 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 79006725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).