About 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone
1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone (PubChem CID 79007041) has the molecular formula C7H10N2OS
and a molecular weight of 170.24 g/mol. Its IUPAC name is 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone |
| PubChem CID | 79007041 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone |
| SMILES | CNc1snc(C)c1C(C)=O |
| InChI | InChI=1S/C7H10N2OS/c1-4-6(5(2)10)7(8-3)11-9-4/h8H,1-3H3 |
| InChIKey | PSQQVKKTKATYLJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone?
The IUPAC name of 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone (CID 79007041) is 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone?
The canonical SMILES for 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone is CNc1snc(C)c1C(C)=O.
What is the InChIKey of 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone?
The InChIKey is PSQQVKKTKATYLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS/c1-4-6(5(2)10)7(8-3)11-9-4/h8H,1-3H3.
What are the key properties of 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone?
1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone has a molecular weight of 170.24 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-methyl-5-(methylamino)-1,2-thiazol-4-yl]ethanone is sourced from PubChem (CID 79007041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).