C18H29N — CID 79007933
2-(3,5-dimethylcyclohexyl)-1-phenylbutan-2-amine (PubChem CID 79007933) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)-1-phenylbutan-2-amine.
| Compound Name | 2-(3,5-dimethylcyclohexyl)-1-phenylbutan-2-amine |
|---|---|
| PubChem CID | 79007933 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)-1-phenylbutan-2-amine |
| SMILES | CCC(N)(Cc1ccccc1)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C18H29N/c1-4-18(19,13-16-8-6-5-7-9-16)17-11-14(2)10-15(3)12-17/h5-9,14-15,17H,4,10-13,19H2,1-3H3 |
| InChIKey | AFISAMCNSJXNRM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |