C16H16F2O — CID 79008246
2-(3,4-difluorophenyl)-1-phenylbutan-2-ol (PubChem CID 79008246) has the molecular formula C16H16F2O and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-phenylbutan-2-ol.
| Compound Name | 2-(3,4-difluorophenyl)-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 79008246 |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-phenylbutan-2-ol |
| SMILES | CCC(O)(Cc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F2O/c1-2-16(19,11-12-6-4-3-5-7-12)13-8-9-14(17)15(18)10-13/h3-10,19H,2,11H2,1H3 |
| InChIKey | HCKUGTGQPCXXRU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |