C12H15F4NO — CID 79009341
(1S)-1-[3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]phenyl]ethanol (PubChem CID 79009341) has the molecular formula C12H15F4NO and a molecular weight of 265.25 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]phenyl]ethanol.
| Compound Name | (1S)-1-[3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 79009341 |
| Molecular Formula | C12H15F4NO |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (1S)-1-[3-fluoro-4-[methyl(3,3,3-trifluoropropyl)amino]phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(N(C)CCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C12H15F4NO/c1-8(18)9-3-4-11(10(13)7-9)17(2)6-5-12(14,15)16/h3-4,7-8,18H,5-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | UYPHCBBNGIZBCR-QMMMGPOBSA-N |
| XLogP | 3.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|