C12H13F3N2O3 — CID 79009946
(2R)-3-methyl-2-[(2,3,5-trifluorophenyl)carbamoylamino]butanoic acid (PubChem CID 79009946) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is (2R)-3-methyl-2-[(2,3,5-trifluorophenyl)carbamoylamino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[(2,3,5-trifluorophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 79009946 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2R)-3-methyl-2-[(2,3,5-trifluorophenyl)carbamoylamino]butanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)Nc1cc(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H13F3N2O3/c1-5(2)10(11(18)19)17-12(20)16-8-4-6(13)3-7(14)9(8)15/h3-5,10H,1-2H3,(H,18,19)(H2,16,17,20)/t10-/m1/s1 |
| InChIKey | QDIJAGSYLJVFJF-SNVBAGLBSA-N |
| XLogP | 2.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|