About (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid
(2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid (PubChem CID 79010010) has the molecular formula C14H18N2O4
and a molecular weight of 278.31 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid.
Molecular Properties
| Compound Name | (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid |
| PubChem CID | 79010010 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)NC1COc2ccccc21)C(=O)O |
| InChI | InChI=1S/C14H18N2O4/c1-8(2)12(13(17)18)16-14(19)15-10-7-20-11-6-4-3-5-9(10)11/h3-6,8,10,12H,7H2,1-2H3,(H,17,18)(H2,15,16,19)/t10?,12-/m1/s1 |
| InChIKey | RPHJEHFAFBWYOV-TVKKRMFBSA-N |
| XLogP | 1.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid?
The IUPAC name of (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid (CID 79010010) is (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid.
What is the SMILES notation for (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid?
The canonical SMILES for (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid is CC(C)[C@@H](NC(=O)NC1COc2ccccc21)C(=O)O.
What is the InChIKey of (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid?
The InChIKey is RPHJEHFAFBWYOV-TVKKRMFBSA-N. The full InChI is InChI=1S/C14H18N2O4/c1-8(2)12(13(17)18)16-14(19)15-10-7-20-11-6-4-3-5-9(10)11/h3-6,8,10,12H,7H2,1-2H3,(H,17,18)(H2,15,16,19)/t10?,12-/m1/s1.
What are the key properties of (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid?
(2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid has a molecular weight of 278.31 g/mol, XLogP of 1.53, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,3-dihydro-1-benzofuran-3-ylcarbamoylamino)-3-methylbutanoic acid is sourced from PubChem (CID 79010010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).