About (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid
(2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 79010860) has the molecular formula C11H22N2O5S
and a molecular weight of 294.37 g/mol. Its IUPAC name is (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid |
| PubChem CID | 79010860 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC1CN(S(=O)(=O)N[C@@H](C(=O)O)C(C)C)CC(C)O1 |
| InChI | InChI=1S/C11H22N2O5S/c1-7(2)10(11(14)15)12-19(16,17)13-5-8(3)18-9(4)6-13/h7-10,12H,5-6H2,1-4H3,(H,14,15)/t8?,9?,10-/m1/s1 |
| InChIKey | CALCYWVZILPWOK-UDNWOFFPSA-N |
| XLogP | 0.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
The IUPAC name of (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid (CID 79010860) is (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid.
What is the SMILES notation for (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
The canonical SMILES for (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid is CC1CN(S(=O)(=O)N[C@@H](C(=O)O)C(C)C)CC(C)O1.
What is the InChIKey of (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
The InChIKey is CALCYWVZILPWOK-UDNWOFFPSA-N. The full InChI is InChI=1S/C11H22N2O5S/c1-7(2)10(11(14)15)12-19(16,17)13-5-8(3)18-9(4)6-13/h7-10,12H,5-6H2,1-4H3,(H,14,15)/t8?,9?,10-/m1/s1.
What are the key properties of (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid?
(2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid has a molecular weight of 294.37 g/mol, XLogP of 0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-3-methylbutanoic acid is sourced from PubChem (CID 79010860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).