C14H22N4O — CID 79011469
(2R)-2-amino-3-methyl-N-(2-pyrrolidin-1-yl-3-pyridinyl)butanamide (PubChem CID 79011469) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-N-(2-pyrrolidin-1-yl-3-pyridinyl)butanamide.
| Compound Name | (2R)-2-amino-3-methyl-N-(2-pyrrolidin-1-yl-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 79011469 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2R)-2-amino-3-methyl-N-(2-pyrrolidin-1-yl-3-pyridinyl)butanamide |
| SMILES | CC(C)[C@@H](N)C(=O)Nc1cccnc1N1CCCC1 |
| InChI | InChI=1S/C14H22N4O/c1-10(2)12(15)14(19)17-11-6-5-7-16-13(11)18-8-3-4-9-18/h5-7,10,12H,3-4,8-9,15H2,1-2H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | ASACQSHXFFIRAX-GFCCVEGCSA-N |
| XLogP | 1.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |