C10H18N4O — CID 79013070
(2R)-2-amino-3-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]butanamide (PubChem CID 79013070) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]butanamide.
| Compound Name | (2R)-2-amino-3-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 79013070 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (2R)-2-amino-3-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]butanamide |
| SMILES | Cc1[nH]ncc1CNC(=O)[C@H](N)C(C)C |
| InChI | InChI=1S/C10H18N4O/c1-6(2)9(11)10(15)12-4-8-5-13-14-7(8)3/h5-6,9H,4,11H2,1-3H3,(H,12,15)(H,13,14)/t9-/m1/s1 |
| InChIKey | JVIIZYMWVFEWQX-SECBINFHSA-N |
| XLogP | 0.32 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |