C10H12ClNO — CID 79014554
(5S)-9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 79014554) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is (5S)-9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | (5S)-9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 79014554 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (5S)-9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | N[C@H]1CCCOc2c(Cl)cccc21 |
| InChI | InChI=1S/C10H12ClNO/c11-8-4-1-3-7-9(12)5-2-6-13-10(7)8/h1,3-4,9H,2,5-6,12H2/t9-/m0/s1 |
| InChIKey | DYZOLKINGZEDSH-VIFPVBQESA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |