C14H23NO4S — CID 79014602
N-cyclopropyl-5-(hydroxymethyl)-2-methyl-N-(3-methylbutyl)furan-3-sulfonamide (PubChem CID 79014602) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-cyclopropyl-5-(hydroxymethyl)-2-methyl-N-(3-methylbutyl)furan-3-sulfonamide.
| Compound Name | N-cyclopropyl-5-(hydroxymethyl)-2-methyl-N-(3-methylbutyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 79014602 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-cyclopropyl-5-(hydroxymethyl)-2-methyl-N-(3-methylbutyl)furan-3-sulfonamide |
| SMILES | Cc1oc(CO)cc1S(=O)(=O)N(CCC(C)C)C1CC1 |
| InChI | InChI=1S/C14H23NO4S/c1-10(2)6-7-15(12-4-5-12)20(17,18)14-8-13(9-16)19-11(14)3/h8,10,12,16H,4-7,9H2,1-3H3 |
| InChIKey | VPXOVGAUSWALAK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |