C11H16N2O2 — CID 79014891
6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 79014891) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 79014891 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | COc1cc2c(cc1OC)NC(C)CN2 |
| InChI | InChI=1S/C11H16N2O2/c1-7-6-12-8-4-10(14-2)11(15-3)5-9(8)13-7/h4-5,7,12-13H,6H2,1-3H3 |
| InChIKey | IMOIQSFDGRIFND-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|