About 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline
4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline (PubChem CID 79015275) has the molecular formula C15H14F2N2
and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 79015275 |
| Molecular Formula | C15H14F2N2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline |
| SMILES | Fc1ccc(CN2CCNc3ccccc32)cc1F |
| InChI | InChI=1S/C15H14F2N2/c16-12-6-5-11(9-13(12)17)10-19-8-7-18-14-3-1-2-4-15(14)19/h1-6,9,18H,7-8,10H2 |
| InChIKey | OWAWXEDJYGAJSF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline (CID 79015275) is 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline is Fc1ccc(CN2CCNc3ccccc32)cc1F.
What is the InChIKey of 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline?
The InChIKey is OWAWXEDJYGAJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2/c16-12-6-5-11(9-13(12)17)10-19-8-7-18-14-3-1-2-4-15(14)19/h1-6,9,18H,7-8,10H2.
What are the key properties of 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline?
4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline has a molecular weight of 260.29 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 79015275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).