C10H14F6N2O — CID 790159
1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea (PubChem CID 790159) has the molecular formula C10H14F6N2O and a molecular weight of 292.22 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea.
| Compound Name | 1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
|---|---|
| PubChem CID | 790159 |
| Molecular Formula | C10H14F6N2O |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoropropan-2-yl)urea |
| SMILES | O=C(NC1CCCCC1)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6N2O/c11-9(12,13)7(10(14,15)16)18-8(19)17-6-4-2-1-3-5-6/h6-7H,1-5H2,(H2,17,18,19) |
| InChIKey | GSEWSBMOXBPNPN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |