C8H10Cl2N2O — CID 79016126
1-(3,5-dichloro-2-pyridinyl)-2-methoxyethanamine (PubChem CID 79016126) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-2-methoxyethanamine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 79016126 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-2-methoxyethanamine |
| SMILES | COCC(N)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C8H10Cl2N2O/c1-13-4-7(11)8-6(10)2-5(9)3-12-8/h2-3,7H,4,11H2,1H3 |
| InChIKey | AYTCIJWWALMRED-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |