About methyl 4-iodo-2,5-dimethylfuran-3-carboxylate
methyl 4-iodo-2,5-dimethylfuran-3-carboxylate (PubChem CID 79016599) has the molecular formula C8H9IO3
and a molecular weight of 280.06 g/mol. Its IUPAC name is methyl 4-iodo-2,5-dimethylfuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-iodo-2,5-dimethylfuran-3-carboxylate |
| PubChem CID | 79016599 |
| Molecular Formula | C8H9IO3 |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | methyl 4-iodo-2,5-dimethylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(C)c1I |
| InChI | InChI=1S/C8H9IO3/c1-4-6(8(10)11-3)7(9)5(2)12-4/h1-3H3 |
| InChIKey | VABGVGUVJYSGDF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-iodo-2,5-dimethylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-iodo-2,5-dimethylfuran-3-carboxylate?
The IUPAC name of methyl 4-iodo-2,5-dimethylfuran-3-carboxylate (CID 79016599) is methyl 4-iodo-2,5-dimethylfuran-3-carboxylate.
What is the SMILES notation for methyl 4-iodo-2,5-dimethylfuran-3-carboxylate?
The canonical SMILES for methyl 4-iodo-2,5-dimethylfuran-3-carboxylate is COC(=O)c1c(C)oc(C)c1I.
What is the InChIKey of methyl 4-iodo-2,5-dimethylfuran-3-carboxylate?
The InChIKey is VABGVGUVJYSGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IO3/c1-4-6(8(10)11-3)7(9)5(2)12-4/h1-3H3.
What are the key properties of methyl 4-iodo-2,5-dimethylfuran-3-carboxylate?
methyl 4-iodo-2,5-dimethylfuran-3-carboxylate has a molecular weight of 280.06 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-iodo-2,5-dimethylfuran-3-carboxylate is sourced from PubChem (CID 79016599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).