C12H12N2O2S — CID 79017133
N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 79017133) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 79017133 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1csc(CNc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H12N2O2S/c1-8-6-17-12(14-8)5-13-9-2-3-10-11(4-9)16-7-15-10/h2-4,6,13H,5,7H2,1H3 |
| InChIKey | GUXCRSBRRAOASI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|