About [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine
[2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine (PubChem CID 79017403) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine.
Molecular Properties
| Compound Name | [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine |
| PubChem CID | 79017403 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine |
| SMILES | Cc1ccc(C2(CN)OCCCO2)cc1C |
| InChI | InChI=1S/C13H19NO2/c1-10-4-5-12(8-11(10)2)13(9-14)15-6-3-7-16-13/h4-5,8H,3,6-7,9,14H2,1-2H3 |
| InChIKey | OIZYRDGREXQZEC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine?
The IUPAC name of [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine (CID 79017403) is [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine.
What is the SMILES notation for [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine?
The canonical SMILES for [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine is Cc1ccc(C2(CN)OCCCO2)cc1C.
What is the InChIKey of [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine?
The InChIKey is OIZYRDGREXQZEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-10-4-5-12(8-11(10)2)13(9-14)15-6-3-7-16-13/h4-5,8H,3,6-7,9,14H2,1-2H3.
What are the key properties of [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine?
[2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine has a molecular weight of 221.30 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethylphenyl)-1,3-dioxan-2-yl]methanamine is sourced from PubChem (CID 79017403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).