About ethyl 3-iodo-5-methylbenzoate
ethyl 3-iodo-5-methylbenzoate (PubChem CID 79018034) has the molecular formula C10H11IO2
and a molecular weight of 290.10 g/mol. Its IUPAC name is ethyl 3-iodo-5-methylbenzoate.
Molecular Properties
| Compound Name | ethyl 3-iodo-5-methylbenzoate |
| PubChem CID | 79018034 |
| Molecular Formula | C10H11IO2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | ethyl 3-iodo-5-methylbenzoate |
| SMILES | CCOC(=O)c1cc(C)cc(I)c1 |
| InChI | InChI=1S/C10H11IO2/c1-3-13-10(12)8-4-7(2)5-9(11)6-8/h4-6H,3H2,1-2H3 |
| InChIKey | VLRLQODPTALXMM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-iodo-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-iodo-5-methylbenzoate?
The IUPAC name of ethyl 3-iodo-5-methylbenzoate (CID 79018034) is ethyl 3-iodo-5-methylbenzoate.
What is the SMILES notation for ethyl 3-iodo-5-methylbenzoate?
The canonical SMILES for ethyl 3-iodo-5-methylbenzoate is CCOC(=O)c1cc(C)cc(I)c1.
What is the InChIKey of ethyl 3-iodo-5-methylbenzoate?
The InChIKey is VLRLQODPTALXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO2/c1-3-13-10(12)8-4-7(2)5-9(11)6-8/h4-6H,3H2,1-2H3.
What are the key properties of ethyl 3-iodo-5-methylbenzoate?
ethyl 3-iodo-5-methylbenzoate has a molecular weight of 290.10 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-iodo-5-methylbenzoate is sourced from PubChem (CID 79018034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).