C11H10IN3O2S — CID 79018401
2-[[5-(3-iodophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 79018401) has the molecular formula C11H10IN3O2S and a molecular weight of 375.19 g/mol. Its IUPAC name is 2-[[5-(3-iodophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(3-iodophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 79018401 |
| Molecular Formula | C11H10IN3O2S |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 2-[[5-(3-iodophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Cn1c(SCC(=O)O)nnc1-c1cccc(I)c1 |
| InChI | InChI=1S/C11H10IN3O2S/c1-15-10(7-3-2-4-8(12)5-7)13-14-11(15)18-6-9(16)17/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | PQTRHIMIPPYFIS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|