C12H17FN2 — CID 79020017
3-fluoro-N-(piperidin-3-ylmethyl)aniline (PubChem CID 79020017) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 3-fluoro-N-(piperidin-3-ylmethyl)aniline.
| Compound Name | 3-fluoro-N-(piperidin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 79020017 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 3-fluoro-N-(piperidin-3-ylmethyl)aniline |
| SMILES | Fc1cccc(NCC2CCCNC2)c1 |
| InChI | InChI=1S/C12H17FN2/c13-11-4-1-5-12(7-11)15-9-10-3-2-6-14-8-10/h1,4-5,7,10,14-15H,2-3,6,8-9H2 |
| InChIKey | GZGYILZMBFKFMB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |