C11H18N2O3 — CID 79020202
ethyl 2-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 79020202) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 2-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | ethyl 2-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 79020202 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl 2-(3-propyl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | CCCc1noc(C(CC)C(=O)OCC)n1 |
| InChI | InChI=1S/C11H18N2O3/c1-4-7-9-12-10(16-13-9)8(5-2)11(14)15-6-3/h8H,4-7H2,1-3H3 |
| InChIKey | ASVNDMUXCZTOEB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |