About 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid
7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid (PubChem CID 79020530) has the molecular formula C12H9NO3
and a molecular weight of 215.21 g/mol. Its IUPAC name is 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid |
| PubChem CID | 79020530 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid |
| SMILES | Cc1ccc2c(c1)-c1onc(C(=O)O)c1C2 |
| InChI | InChI=1S/C12H9NO3/c1-6-2-3-7-5-9-10(12(14)15)13-16-11(9)8(7)4-6/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | WESJWIXWJGRJQX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid?
The IUPAC name of 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid (CID 79020530) is 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid.
What is the SMILES notation for 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid?
The canonical SMILES for 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid is Cc1ccc2c(c1)-c1onc(C(=O)O)c1C2.
What is the InChIKey of 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid?
The InChIKey is WESJWIXWJGRJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3/c1-6-2-3-7-5-9-10(12(14)15)13-16-11(9)8(7)4-6/h2-4H,5H2,1H3,(H,14,15).
What are the key properties of 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid?
7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid has a molecular weight of 215.21 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4H-indeno[2,1-d][1,2]oxazole-3-carboxylic acid is sourced from PubChem (CID 79020530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).