About 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide
2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 790215) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide |
| PubChem CID | 790215 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(C(=O)Nc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C21H19N3O2/c1-14-6-3-8-16(12-14)22-20(25)18-10-5-11-19(24-18)21(26)23-17-9-4-7-15(2)13-17/h3-13H,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | AWJBOFHHXKIQGK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide?
The IUPAC name of 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide (CID 790215) is 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide.
What is the SMILES notation for 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide?
The canonical SMILES for 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide is Cc1cccc(NC(=O)c2cccc(C(=O)Nc3cccc(C)c3)n2)c1.
What is the InChIKey of 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide?
The InChIKey is AWJBOFHHXKIQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c1-14-6-3-8-16(12-14)22-20(25)18-10-5-11-19(24-18)21(26)23-17-9-4-7-15(2)13-17/h3-13H,1-2H3,(H,22,25)(H,23,26).
What are the key properties of 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide?
2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide has a molecular weight of 345.40 g/mol, XLogP of 4.20, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-bis(3-methylphenyl)pyridine-2,6-dicarboxamide is sourced from PubChem (CID 790215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).