C13H9IN2O — CID 79022155
2-(3-iodophenyl)-1,3-benzoxazol-4-amine (PubChem CID 79022155) has the molecular formula C13H9IN2O and a molecular weight of 336.13 g/mol. Its IUPAC name is 2-(3-iodophenyl)-1,3-benzoxazol-4-amine.
| Compound Name | 2-(3-iodophenyl)-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 79022155 |
| Molecular Formula | C13H9IN2O |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 2-(3-iodophenyl)-1,3-benzoxazol-4-amine |
| SMILES | Nc1cccc2oc(-c3cccc(I)c3)nc12 |
| InChI | InChI=1S/C13H9IN2O/c14-9-4-1-3-8(7-9)13-16-12-10(15)5-2-6-11(12)17-13/h1-7H,15H2 |
| InChIKey | SIABECAXGONTHY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|