About 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide
3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide (PubChem CID 790225) has the molecular formula C17H11NO3S
and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 790225 |
| Molecular Formula | C17H11NO3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(Oc2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C17H11NO3S/c19-22(20)16-11-4-3-9-14(16)17(18-22)21-15-10-5-7-12-6-1-2-8-13(12)15/h1-11H |
| InChIKey | PVYYHPVCCGWYIM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide (CID 790225) is 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide is O=S1(=O)N=C(Oc2cccc3ccccc23)c2ccccc21.
What is the InChIKey of 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide?
The InChIKey is PVYYHPVCCGWYIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO3S/c19-22(20)16-11-4-3-9-14(16)17(18-22)21-15-10-5-7-12-6-1-2-8-13(12)15/h1-11H.
What are the key properties of 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide?
3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide has a molecular weight of 309.35 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-1-yloxy-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 790225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).