About methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate
methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate (PubChem CID 79023593) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate |
| PubChem CID | 79023593 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate |
| SMILES | CCC(=CCn1c(=O)ccn(C)c1=O)C(=O)OC |
| InChI | InChI=1S/C12H16N2O4/c1-4-9(11(16)18-3)5-8-14-10(15)6-7-13(2)12(14)17/h5-7H,4,8H2,1-3H3 |
| InChIKey | SWCNHXPEVWROMR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate (CID 79023593) is methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate is CCC(=CCn1c(=O)ccn(C)c1=O)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate?
The InChIKey is SWCNHXPEVWROMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-4-9(11(16)18-3)5-8-14-10(15)6-7-13(2)12(14)17/h5-7H,4,8H2,1-3H3.
What are the key properties of methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate?
methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate has a molecular weight of 252.27 g/mol, XLogP of 0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-(3-methyl-2,6-dioxopyrimidin-1-yl)but-2-enoate is sourced from PubChem (CID 79023593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).