methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate

C12H16N2O4 — CID 79023601

IUPACmethyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate
SMILESCCC(=CCn1ccn(C)c(=O)c1=O)C(=O)OC
InChIInChI=1S/C12H16N2O4/c1-4-9(12(17)18-3)5-6-14-8-7-13(2)10(15)11(14)16/h5,7-8H,4,6H2,1-3H3
InChIKeyVWEIYKPGVYOGQC-UHFFFAOYSA-N
MW252.27 g/mol
LogP0.06
Rot. Bonds4

About methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate

methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate (PubChem CID 79023601) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate.

Molecular Properties

Compound Namemethyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate
PubChem CID79023601
Molecular FormulaC12H16N2O4
Molecular Weight252.27 g/mol
Exact Mass252.11
IUPAC Namemethyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate
SMILESCCC(=CCn1ccn(C)c(=O)c1=O)C(=O)OC
InChIInChI=1S/C12H16N2O4/c1-4-9(12(17)18-3)5-6-14-8-7-13(2)10(15)11(14)16/h5,7-8H,4,6H2,1-3H3
InChIKeyVWEIYKPGVYOGQC-UHFFFAOYSA-N
XLogP0.06
TPSA70.30 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 50.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate (CID 79023601) is methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate is CCC(=CCn1ccn(C)c(=O)c1=O)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate?
The InChIKey is VWEIYKPGVYOGQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-4-9(12(17)18-3)5-6-14-8-7-13(2)10(15)11(14)16/h5,7-8H,4,6H2,1-3H3.
What are the key properties of methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate?
methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate has a molecular weight of 252.27 g/mol, XLogP of 0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-(4-methyl-2,3-dioxopyrazin-1-yl)but-2-enoate is sourced from PubChem (CID 79023601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).