About methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate
methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate (PubChem CID 79023603) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate.
Molecular Properties
| Compound Name | methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate |
| PubChem CID | 79023603 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate |
| SMILES | CCCn1ccc(=O)n(CC=C(CC)C(=O)OC)c1=O |
| InChI | InChI=1S/C14H20N2O4/c1-4-8-15-9-7-12(17)16(14(15)19)10-6-11(5-2)13(18)20-3/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | DAKLMDPHWYNCOP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate?
The IUPAC name of methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate (CID 79023603) is methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate.
What is the SMILES notation for methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate?
The canonical SMILES for methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate is CCCn1ccc(=O)n(CC=C(CC)C(=O)OC)c1=O.
What is the InChIKey of methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate?
The InChIKey is DAKLMDPHWYNCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-4-8-15-9-7-12(17)16(14(15)19)10-6-11(5-2)13(18)20-3/h6-7,9H,4-5,8,10H2,1-3H3.
What are the key properties of methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate?
methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate has a molecular weight of 280.32 g/mol, XLogP of 0.93, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,6-dioxo-3-propylpyrimidin-1-yl)-2-ethylbut-2-enoate is sourced from PubChem (CID 79023603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).