About N-tert-butyl-3,4-dichlorobenzamide
N-tert-butyl-3,4-dichlorobenzamide (PubChem CID 790280) has the molecular formula C11H13Cl2NO
and a molecular weight of 246.14 g/mol. Its IUPAC name is N-tert-butyl-3,4-dichlorobenzamide.
Molecular Properties
| Compound Name | N-tert-butyl-3,4-dichlorobenzamide |
| PubChem CID | 790280 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | N-tert-butyl-3,4-dichlorobenzamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NO/c1-11(2,3)14-10(15)7-4-5-8(12)9(13)6-7/h4-6H,1-3H3,(H,14,15) |
| InChIKey | DRRHRGANNZZVHF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-3,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,4-dichlorobenzamide?
The IUPAC name of N-tert-butyl-3,4-dichlorobenzamide (CID 790280) is N-tert-butyl-3,4-dichlorobenzamide.
What is the SMILES notation for N-tert-butyl-3,4-dichlorobenzamide?
The canonical SMILES for N-tert-butyl-3,4-dichlorobenzamide is CC(C)(C)NC(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of N-tert-butyl-3,4-dichlorobenzamide?
The InChIKey is DRRHRGANNZZVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NO/c1-11(2,3)14-10(15)7-4-5-8(12)9(13)6-7/h4-6H,1-3H3,(H,14,15).
What are the key properties of N-tert-butyl-3,4-dichlorobenzamide?
N-tert-butyl-3,4-dichlorobenzamide has a molecular weight of 246.14 g/mol, XLogP of 3.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,4-dichlorobenzamide is sourced from PubChem (CID 790280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).