C14H15N3O2 — CID 79029003
[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone (PubChem CID 79029003) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone.
| Compound Name | [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone |
|---|---|
| PubChem CID | 79029003 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-quinoxalin-2-ylmethanone |
| SMILES | O=C(c1cnc2ccccc2n1)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C14H15N3O2/c18-9-10-4-3-7-17(10)14(19)13-8-15-11-5-1-2-6-12(11)16-13/h1-2,5-6,8,10,18H,3-4,7,9H2/t10-/m1/s1 |
| InChIKey | FPUJAGLHEXTKOL-SNVBAGLBSA-N |
| XLogP | 1.23 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |